| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:04 UTC |
|---|
| Update Date | 2025-03-25 00:55:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02210707 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H13NO |
|---|
| Molecular Mass | 199.0997 |
|---|
| SMILES | CC(=O)C1=CC(=Cc2ccccc2)CN1 |
|---|
| InChI Key | YBONHTZQEXASHH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkylamineshydrocarbon derivativesketonesorganic oxidesorganopnictogen compoundspyrrolines |
|---|
| Substituents | secondary aliphatic aminemonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundazacyclesecondary amineketoneorganic oxideorganic oxygen compoundpyrrolineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compoundamine |
|---|
