| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:15 UTC |
|---|
| Update Date | 2025-03-25 00:55:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211131 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9ClN2O2 |
|---|
| Molecular Mass | 212.0353 |
|---|
| SMILES | CC(=O)NC(=O)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | FWWDETPIOUIMFM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | n-phenylureas |
|---|
| Direct Parent | n-acyl-phenylureas |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesaryl chloridescarbonyl compoundscarboxylic acids and derivativeschlorobenzenesdicarboximideshydrocarbon derivativesn-acyl ureasorganic carbonic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | carbonyl grouporganochloridecarboxylic acid derivativeorganohalogen compoundorganic oxiden-acyl-phenylureaorganonitrogen compoundorganopnictogen compounddicarboximideureideacetamidearyl chloridechlorobenzenen-acyl ureacarbonic acid derivativearyl halidearomatic homomonocyclic compoundorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
