| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:16 UTC |
|---|
| Update Date | 2025-03-25 00:55:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211169 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H26N2O2 |
|---|
| Molecular Mass | 290.1994 |
|---|
| SMILES | CC(=O)N1CCC(Oc2ccc(CCN(C)C)cc2)CC1 |
|---|
| InChI Key | HLBKYSSQJJAJFQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | n-acylpiperidines |
|---|
| Direct Parent | n-acylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenethylaminesphenol ethersphenoxy compoundstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesalkyl aryl etherphenethylaminecarboxylic acid derivativeorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundtertiary amineacetamideazacycletertiary aliphatic aminecarboxamide groupn-acyl-piperidineorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
