| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:16 UTC |
|---|
| Update Date | 2025-03-25 00:55:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211173 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16FNO2 |
|---|
| Molecular Mass | 237.1165 |
|---|
| SMILES | CC(=O)N1CCC(C)(c2ccc(F)cc2)OC1 |
|---|
| InChI Key | IBBZCJAJGKKRLK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | fluorobenzenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-oxazinanesacetamidesaryl fluoridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundstertiary carboxylic acid amides |
|---|
| Substituents | aryl fluoridecarbonyl grouparomatic heteromonocyclic compoundcarboxylic acid derivativeorganohalogen compoundfluorobenzeneorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundacetamideazacycleorganofluoride1,3-oxazinanecarboxamide groupoxazinanearyl halideoxacycleorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|