| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:16 UTC |
|---|
| Update Date | 2025-03-25 00:55:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211187 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H21N3O2 |
|---|
| Molecular Mass | 347.1634 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(Oc3ccnc4ccccc34)cc2)CC1 |
|---|
| InChI Key | PPZOTOQFBYGJGJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesacetamidesamino acids and derivativesaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylaminesdiarylethersheteroaromatic compoundshydrocarbon derivativesmethylpyridinesn-arylpiperazinesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundspolyhalopyridinesquinolines and derivativestertiary carboxylic acid amides |
|---|
| Substituents | diaryl etherphenol ethermonocyclic benzene moietycarbonyl groupetheramino acid or derivativespolyhalopyridinecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundtertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundquinolineorganopnictogen compound2-halopyridinedialkylarylaminetertiary amineacetamideazacycleaniline or substituted anilinesheteroaromatic compoundmethylpyridinecarboxamide groupphenylpiperazinepyridineorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|
