| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:16 UTC |
|---|
| Update Date | 2025-03-25 00:55:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211191 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C25H26Cl3N5O4 |
|---|
| Molecular Mass | 565.105 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(OCC3COC(Cn4cncn4)(c4c(Cl)cc(Cl)cc4Cl)O3)cc2)CC1 |
|---|
| InChI Key | LPAHGYTVIQCWKN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesacetamidesalkyl aryl ethersamino acids and derivativesaminophenyl ethersaniline and substituted anilinesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzenesdialkylarylaminesheteroaromatic compoundshydrocarbon derivativesketalsn-arylpiperazinesorganic oxidesorganochloridesorganopnictogen compoundsoxacyclic compoundsphenoxy compoundstertiary carboxylic acid amidestriazoles |
|---|
| Substituents | phenol ethertriazolemonocyclic benzene moietymeta-dioxolanecarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesorganochloridealkyl aryl ethercarboxylic acid derivativeorganohalogen compoundorganic oxideacetalketaltertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylamineaminophenyl ethertertiary amineacetamideazolearyl chloridechlorobenzene1,2,4-triazoleazacycleaniline or substituted anilinesheteroaromatic compoundcarboxamide grouparyl halidephenylpiperazineoxacycleorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzenephenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|