Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 15:04:17 UTC |
---|
Update Date | 2025-03-25 00:55:13 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02211229 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C40H66N2O31 |
---|
Molecular Mass | 1070.365 |
---|
SMILES | CC(=O)NC1C(OCC2OC(OC3C(CO)OC(O)C(O)C3O)C(O)C(OC3OC(CO)C(O)C(OC4OC(C(=O)O)C(O)C(O)C4O)C3NC(C)=O)C2O)OC(CO)C(O)C1OC1OC(C)C(O)C(O)C1O |
---|
InChI Key | MFHIKVUNLDPBSS-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | n-acyl-alpha-hexosamines |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | acetalsacetamidesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
---|
Substituents | carbonyl groupcarboxylic acidglucuronic acid or derivativeso-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidn-acyl-alpha-hexosamine1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholpyran carboxylic acid or derivativeshydroxy acidcarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
---|