| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:18 UTC |
|---|
| Update Date | 2025-03-25 00:55:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211251 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14NO7P |
|---|
| Molecular Mass | 267.0508 |
|---|
| SMILES | CC(=O)NC1CC2OP(=O)(O)OC2C(O)C1O |
|---|
| InChI Key | JHWKFPGXDNQRFJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | organic phosphoric acids and derivatives |
|---|
| Direct Parent | organic phosphoric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacetamidescarbonyl compoundscarboxylic acids and derivativescyclic alcohols and derivativesdioxaphospholaneshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholcarbonyl group1,3_dioxaphospholanecyclic alcoholcarboxamide groupcarboxylic acid derivativealiphatic heteropolycyclic compoundoxacyclesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganoheterocyclic compoundacetamideorganooxygen compound1,2-diol |
|---|
