| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:21 UTC |
|---|
| Update Date | 2025-03-25 00:55:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211393 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H15NO6 |
|---|
| Molecular Mass | 329.0899 |
|---|
| SMILES | CC(=O)Nc1c(O)cc(O)c2c1C(=O)CC(c1ccc(O)cc1)O2 |
|---|
| InChI Key | YMLQUQUZMRQQTN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavans |
|---|
| Direct Parent | flavanones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4'-hydroxyflavonoids6-hydroxyflavonoids8-hydroxyflavonoidsacetamidesalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativescarboxylic acids and derivativeschromoneshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | 8-hydroxyflavonoidmonocyclic benzene moietycarbonyl groupetheraryl alkyl ketonen-acetylarylamine1-benzopyranflavanone1-hydroxy-2-unsubstituted benzenoidn-arylamidealkyl aryl ethercarboxylic acid derivativeketoneorganic oxidechromonearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundchromaneorganoheterocyclic compoundacetamidevinylogous amidebenzopyran6-hydroxyflavonoidcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compound4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundaryl ketone |
|---|
