| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:22 UTC |
|---|
| Update Date | 2025-03-25 00:55:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211415 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9F2NO4 |
|---|
| Molecular Mass | 245.05 |
|---|
| SMILES | CC(=O)Nc1ccc(OC(F)(F)C(=O)O)cc1 |
|---|
| InChI Key | FNDZQMGBZIQTPT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxyacetic acid derivatives |
|---|
| Direct Parent | phenoxyacetic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesalkyl fluoridesalpha-halocarboxylic acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesn-acetylarylaminesorganic oxidesorganofluoridesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | alpha-halocarboxylic acid or derivativesphenol etherphenoxyacetatecarbonyl groupcarboxylic acidn-acetylarylaminen-arylamidealpha-halocarboxylic acidcarboxylic acid derivativeorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compoundalkyl halideacetamideacetanilidealkyl fluorideorganofluoridecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
