| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:22 UTC |
|---|
| Update Date | 2025-03-25 00:55:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211437 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12ClNO4S |
|---|
| Molecular Mass | 277.0176 |
|---|
| SMILES | CC(=O)NCCS(=O)(=O)c1ccc(O)c(Cl)c1 |
|---|
| InChI Key | PTILLVNNYYWQBP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonyl compounds |
|---|
| Direct Parent | benzenesulfonyl compounds |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetamidesaryl chloridescarbonyl compoundscarboxylic acids and derivativeschlorobenzeneshalophenolshydrocarbon derivativeso-chlorophenolsorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidessulfones |
|---|
| Substituents | carbonyl grouporganochloride1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidebenzenesulfonyl grouparyl chloride2-chlorophenolchlorobenzenecarboxamide grouparyl halidearomatic homomonocyclic compound2-halophenolsecondary carboxylic acid amidesulfonylorganic oxygen compoundphenolhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compoundsulfone |
|---|