| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:24 UTC |
|---|
| Update Date | 2025-03-25 00:55:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211515 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12ClN3O5 |
|---|
| Molecular Mass | 289.0465 |
|---|
| SMILES | CC(=O)Nc1ccn(C2OC(Cl)C(O)C2O)c(=O)n1 |
|---|
| InChI Key | PUIZJBAGLSNSFT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | n-arylamides |
|---|
| Direct Parent | n-acetylarylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacetamidesalkyl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorohydrinsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganochloridesorganopnictogen compoundsoxacyclic compoundspyrimidonessecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl groupchlorohydrinn-acetylarylaminearomatic heteromonocyclic compoundalkyl chlorideorganochloridemonosaccharidepyrimidonecarboxylic acid derivativeorganohalogen compoundpyrimidinesaccharideorganic oxideorganopnictogen compoundalkyl halideimidolactamorganoheterocyclic compoundacetamide1,2-diolalcoholcarbonic acid derivativeazacycletetrahydrofuranhalohydrinheteroaromatic compoundcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|