| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:24 UTC |
|---|
| Update Date | 2025-03-25 00:55:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211519 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11NO4S |
|---|
| Molecular Mass | 241.0409 |
|---|
| SMILES | CC(=O)Nc1ccccc1S(=O)CC(=O)O |
|---|
| InChI Key | HWUBZXTYILRYQH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsphenyl sulfoxidessecondary carboxylic acid amidessulfinyl compoundssulfoxides |
|---|
| Substituents | carbonyl groupcarboxylic acidn-acetylarylaminen-arylamideorganosulfur compoundcarboxylic acid derivativeorganic oxidephenyl sulfoxidesulfinyl compoundorganonitrogen compoundorganopnictogen compoundacetamideacetanilidecarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsulfoxidehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|