| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:25 UTC |
|---|
| Update Date | 2025-03-25 00:55:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211543 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H12O4 |
|---|
| Molecular Mass | 220.0736 |
|---|
| SMILES | CC(=O)OC(=O)CC(=O)c1ccccc1C |
|---|
| InChI Key | REUVZXVQHZNKSU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl alkyl ketonesbenzoyl derivativesbeta-keto acids and derivativescarboxylic acid anhydridesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidestoluenes |
|---|
| Substituents | monocyclic benzene moietyaryl alkyl ketonebenzoylcarboxylic acid derivativebeta-keto acidaromatic homomonocyclic compoundorganic oxideketo acidcarboxylic acid anhydridedicarboxylic acid or derivativeshydrocarbon derivativebenzenoidtoluenealkyl-phenylketone |
|---|
