| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:27 UTC |
|---|
| Update Date | 2025-03-25 00:55:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211632 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H21N3O3 |
|---|
| Molecular Mass | 267.1583 |
|---|
| SMILES | CC(=O)NCCCNCCCNC(=O)c1ccco1 |
|---|
| InChI Key | PLEYUTPJMGIESQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furans |
|---|
| Subclass | furoic acid and derivatives |
|---|
| Direct Parent | furoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidesacetamidesamino acids and derivativescarbonyl compoundscarboxylic acids and derivativesdialkylaminesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amides |
|---|
| Substituents | secondary aliphatic aminecarbonyl groupfuroic acid or derivativesaromatic heteromonocyclic compoundamino acid or derivativesheteroaromatic compoundsecondary aminecarboxamide groupcarboxylic acid derivative2-heteroaryl carboxamideoxacyclesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundacetamideorganooxygen compoundamine |
|---|
