| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:28 UTC |
|---|
| Update Date | 2025-03-25 00:55:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02211646 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H22N2O |
|---|
| Molecular Mass | 234.1732 |
|---|
| SMILES | CC(=O)NCCCN(C)c1c(C)cccc1C |
|---|
| InChI Key | PVUUCDOCDDQXGI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | xylenes |
|---|
| Direct Parent | m-xylenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaniline and substituted anilinescarbonyl compoundscarboxylic acids and derivativesdialkylarylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupamino acid or derivativesaniline or substituted anilinesm-xylenecarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxideorganic oxygen compoundtertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compounddialkylarylamineaminetertiary amineacetamideorganooxygen compound |
|---|
