| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:04:56 UTC |
|---|
| Update Date | 2025-03-25 00:55:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02212795 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H22O7 |
|---|
| Molecular Mass | 278.1366 |
|---|
| SMILES | CCCCCC(=O)OC(C(O)CO)C(O)C(O)C=O |
|---|
| InChI Key | VAFYDRPELFLFLD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty alcohols |
|---|
| Direct Parent | fatty alcohols |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acid estersfatty acid estershydrocarbon derivativesmedium-chain aldehydesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundbeta-hydroxy aldehydecarbonyl groupmonosaccharidealdehydecarboxylic acid derivativemedium-chain aldehydefatty acid estersaccharideorganic oxidemonocarboxylic acid or derivativesalpha-hydroxyaldehydeorganic oxygen compoundfatty alcoholcarboxylic acid estersecondary alcoholhydrocarbon derivativeprimary alcoholorganooxygen compound |
|---|