| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:00 UTC |
|---|
| Update Date | 2025-03-25 00:55:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02212956 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H33NO8 |
|---|
| Molecular Mass | 391.2206 |
|---|
| SMILES | CCCCCCCC(O)CC(=O)OC1C(O)C(CO)OC(O)C1N=C(C)O |
|---|
| InChI Key | TYUIMSDJPZOOIV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscarboximidic acidscarboxylic acid estersfatty acid estershemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspropargyl-type 1,3-dipolar organic compoundssaccharolipidssecondary alcohols |
|---|
| Substituents | fatty acylcarboximidic acidcarbonyl groupmonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosaminepropargyl-type 1,3-dipolar organic compoundbeta-hydroxy acidorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholorganic 1,3-dipolar compoundhydroxy acidacylaminosugaroxacyclefatty acid estermonocarboxylic acid or derivativescarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundsaccharolipid |
|---|