| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:04 UTC |
|---|
| Update Date | 2025-03-25 00:55:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02213118 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H30N2O3 |
|---|
| Molecular Mass | 286.2256 |
|---|
| SMILES | CCCCCCC(=O)N1CCN(CCOCCO)CC1 |
|---|
| InChI Key | OUAYRQWGYXMMBX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | n-alkylpiperazines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesorganic oxidesorganopnictogen compoundstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | carbonyl groupetheramino acid or derivativescarboxylic acid derivativedialkyl etherorganic oxidetertiary carboxylic acid amidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundtertiary aminealcoholazacyclen-alkylpiperazinetertiary aliphatic aminecarboxamide grouporganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|