| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:08 UTC |
|---|
| Update Date | 2025-03-25 00:55:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02213252 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9NO3 |
|---|
| Molecular Mass | 191.0582 |
|---|
| SMILES | CN1C(=O)C(O)(c2ccccc2)C1=O |
|---|
| InChI Key | QGVASPXXGJUOLK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azetidines |
|---|
| Subclass | phenylazetidines |
|---|
| Direct Parent | phenylazetidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesbeta lactamscarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundstertiary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl grouplactamaromatic heteromonocyclic compoundazacycle3-phenylazetidinecarboxylic acid derivativetertiary alcoholorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoiddicarboximideorganic nitrogen compoundbeta-lactamorganooxygen compound |
|---|
