| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:10 UTC |
|---|
| Update Date | 2025-03-25 00:55:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02213351 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H27N3O4 |
|---|
| Molecular Mass | 361.2002 |
|---|
| SMILES | CN(C)Cc1ccc(CNCC(O)COc2ccc(CC(N)=O)cc2)o1 |
|---|
| InChI Key | QQVOQDLRFOJKDE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersamino acids and derivativesaralkylaminescarbonyl compoundscarboxylic acids and derivativesdialkylaminesfuransheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenol ethersphenoxy compoundsprimary carboxylic acid amidessecondary alcoholstrialkylamines |
|---|
| Substituents | primary carboxylic acid amidefuranphenol ethercarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesalkyl aryl ethercarboxylic acid derivativearalkylamineorganic oxideorganonitrogen compoundorganopnictogen compoundphenylacetamidetertiary amineorganoheterocyclic compoundalcoholsecondary aliphatic amineheteroaromatic compoundtertiary aliphatic aminesecondary aminecarboxamide groupoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
