| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:12 UTC |
|---|
| Update Date | 2025-03-25 00:55:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02213408 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H28FNO2 |
|---|
| Molecular Mass | 321.2104 |
|---|
| SMILES | CN(C)CCCC1(c2ccc(F)cc2)CCC(CC(=O)O)CC1 |
|---|
| InChI Key | CJCCMKZLUJIISX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylbutylamines |
|---|
| Direct Parent | phenylbutylamines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acidsaryl fluoridescarbonyl compoundscarboxylic acidsfluorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganopnictogen compoundstrialkylamines |
|---|
| Substituents | aryl fluoridecarbonyl groupcarboxylic acidamino acid or derivativesamino acidcarboxylic acid derivativeorganohalogen compoundfluorobenzeneorganic oxidephenylbutylamineorganonitrogen compoundorganopnictogen compoundtertiary amineorganofluoridetertiary aliphatic aminearyl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|
