| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:13 UTC |
|---|
| Update Date | 2025-03-25 00:55:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02213466 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H21N7OS |
|---|
| Molecular Mass | 347.1528 |
|---|
| SMILES | CN(C)Cc1ccc(CSCCNc2nc(N)nc3nc[nH]c23)o1 |
|---|
| InChI Key | ZBLBSEGJXDTFMA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aralkylaminesazacyclic compoundsdialkylthioethersfuransheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsprimary aminespyrimidines and pyrimidine derivativessecondary alkylarylaminessulfenyl compoundstrialkylamines |
|---|
| Substituents | furanorganosulfur compoundaralkylaminepyrimidinearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamtertiary amineazolesulfenyl compoundazacycledialkylthioetherheteroaromatic compoundtertiary aliphatic aminesecondary aminesecondary aliphatic/aromatic amineoxacycleorganic oxygen compoundthioetherhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
