| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:13 UTC |
|---|
| Update Date | 2025-03-25 00:55:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02213467 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N6O |
|---|
| Molecular Mass | 220.1073 |
|---|
| SMILES | CN(C)Cc1cnc2c(N)nc(O)nc2n1 |
|---|
| InChI Key | JWKNHRUJZFFTEO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aralkylaminesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidolactamsorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinestrialkylamines |
|---|
| Substituents | azacycleheteroaromatic compoundtertiary aliphatic aminehydroxypyrimidinepteridinearalkylaminepyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamaminetertiary amineorganooxygen compound |
|---|
