| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:15 UTC |
|---|
| Update Date | 2025-03-25 00:55:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02213532 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H13ClN5O5P |
|---|
| Molecular Mass | 361.0343 |
|---|
| SMILES | CNc1ncnc2c1ncn2C1OC2COP(=O)(O)OC2C1Cl |
|---|
| InChI Key | CMOUVANHSOTMPG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl chloridesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganochloridesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundspyrimidines and pyrimidine derivativessecondary alkylarylaminestetrahydrofurans |
|---|
| Substituents | alkyl chlorideorganochlorideorganohalogen compoundpyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundalkyl halideimidolactamazolen-substituted imidazoleazacycletetrahydrofuranheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineoxacycleorganic oxygen compoundhydrocarbon derivativepurineorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compoundamine |
|---|
