| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:20 UTC |
|---|
| Update Date | 2025-03-25 00:55:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02213723 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20N2O |
|---|
| Molecular Mass | 244.1576 |
|---|
| SMILES | CNC1(O)CCC(c2c[nH]c3ccccc23)CC1 |
|---|
| InChI Key | NJRYXVPZGCFSFF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidscyclic alcohols and derivativescyclohexanolsdialkylamineshemiaminalsheteroaromatic compoundshydrocarbon derivativesorganooxygen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | secondary aliphatic amineazacycleindoleheteroaromatic compoundcyclohexanolcyclic alcoholsecondary aminehemiaminalorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundaminealkanolamine |
|---|