| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:21 UTC |
|---|
| Update Date | 2025-03-25 00:55:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02213766 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H7F3N2O |
|---|
| Molecular Mass | 204.051 |
|---|
| SMILES | CNC(=O)c1cncc(C(F)(F)F)c1 |
|---|
| InChI Key | IPXFWSRAELUMOX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | pyridinecarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesmethylpyridinesnicotinamidesorganic oxidesorganofluoridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinessecondary carboxylic acid amides |
|---|
| Substituents | pyridine carboxylic acid or derivativesaromatic heteromonocyclic compoundazacyclepolyhalopyridinealkyl fluorideorganofluoridenicotinamideheteroaromatic compoundmethylpyridinecarboxamide groupcarboxylic acid derivativeorganohalogen compoundsecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundalkyl halidehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
