| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:25 UTC |
|---|
| Update Date | 2025-03-25 00:55:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02213891 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H29NO2 |
|---|
| Molecular Mass | 291.2198 |
|---|
| SMILES | CCNC(C)C(c1ccc(OC)cc1)C1(O)CCCCC1 |
|---|
| InChI Key | SVMZBCODWIBGGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpropanes |
|---|
| Direct Parent | phenylpropanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescyclic alcohols and derivativescyclohexanolsdialkylamineshydrocarbon derivativesmethoxybenzenesorganopnictogen compoundsphenoxy compoundstertiary alcohols |
|---|
| Substituents | alcoholphenol ethersecondary aliphatic amineethercyclohexanolcyclic alcoholalkyl aryl ethersecondary aminemethoxybenzenephenylpropanearomatic homomonocyclic compoundtertiary alcoholorganic oxygen compoundanisoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compoundamine |
|---|
