| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:26 UTC |
|---|
| Update Date | 2025-03-25 00:55:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02213953 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H28Cl4N2O3 |
|---|
| Molecular Mass | 580.0854 |
|---|
| SMILES | CCN1CCN(c2ccc(OCC3COC(c4ccc(Cl)cc4Cl)(c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
|---|
| InChI Key | DOEMSOAIPPTKOK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesalkyl aryl ethersaminophenyl ethersaniline and substituted anilinesaryl chloridesazacyclic compoundsdialkylarylaminesdichlorobenzeneshydrocarbon derivativesketalsn-alkylpiperazinesn-arylpiperazinesorganochloridesorganopnictogen compoundsoxacyclic compoundsphenoxy compoundsphenylpiperazinestrialkylamines |
|---|
| Substituents | diphenylmethanephenol ethermeta-dioxolaneetheraromatic heteromonocyclic compoundorganochloridealkyl aryl etherorganohalogen compound1,3-dichlorobenzeneacetalpiperazineketaltertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylamineaminophenyl ethertertiary amineorganoheterocyclic compoundaryl chloridechlorobenzeneazacycleaniline or substituted anilinesn-alkylpiperazinetertiary aliphatic aminearyl halidephenylpiperazineoxacycleorganic oxygen compound1,4-diazinanehydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|
