| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:28 UTC |
|---|
| Update Date | 2025-03-25 00:55:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02214019 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H17N5O2 |
|---|
| Molecular Mass | 299.1382 |
|---|
| SMILES | C=CC1=C(C)C(=CC=NO)N(Cc2cnc(C)nc2N)C1=O |
|---|
| InChI Key | DKGZQAXSWSHGRJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamslactamsorganic oxidesorganopnictogen compoundsprimary aminespyrrolinestertiary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamaromatic heteromonocyclic compoundazacycleamino acid or derivativesheteroaromatic compoundcarboxamide groupcarboxylic acid derivativepyrimidineorganic oxideorganic oxygen compoundpyrrolinetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamineorganooxygen compound |
|---|
