| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:34 UTC |
|---|
| Update Date | 2025-03-25 00:55:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02214234 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H23NO12 |
|---|
| Molecular Mass | 397.122 |
|---|
| SMILES | CN(C)C1C(OC2C(C(=O)O)OC(O)C(O)C2O)OC(C(=O)O)C(O)C1O |
|---|
| InChI Key | ASUIHNKJBYAYBC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | aminoglycosides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsacetalsamino acidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativeshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidspyranoid amino acids and derivativessecondary alcoholstrialkylamines |
|---|
| Substituents | carbonyl groupcarboxylic acidglucuronic acid or derivativesamino acid or derivativesamino acidpyranoid amino acidmonosaccharidecarboxylic acid derivativepyran carboxylic acidbeta-hydroxy acidorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundaminoglycoside coreorganopnictogen compoundhemiacetaloxanetertiary amineorganoheterocyclic compoundalcoholpyran carboxylic acid or derivatives1,2-aminoalcoholtertiary aliphatic aminehydroxy acidoxacyclepyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundamine |
|---|
