| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:34 UTC |
|---|
| Update Date | 2025-03-25 00:55:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02214251 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H17NO5 |
|---|
| Molecular Mass | 219.1107 |
|---|
| SMILES | CN(C)CC1(C(=O)O)CC(O)C(CO)O1 |
|---|
| InChI Key | DHULHVMPBOESGF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | furanoid amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidscarbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofuranstrialkylamines |
|---|
| Substituents | carbonyl groupethercarboxylic acidamino acid or derivativesamino acidmonosaccharidecarboxylic acid derivativedialkyl etherorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundfuranoid amino acidprimary alcoholtertiary amineorganoheterocyclic compoundalcoholtetrahydrofurantertiary aliphatic amineoxacyclemonocarboxylic acid or derivativessecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamine |
|---|