| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:36 UTC |
|---|
| Update Date | 2025-03-25 00:55:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02214312 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20FNO3 |
|---|
| Molecular Mass | 281.1427 |
|---|
| SMILES | CCOC(=O)N1CCC(CO)(c2ccc(F)cc2)CC1 |
|---|
| InChI Key | SVVBUHRTLTUNEV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | phenylpiperidines |
|---|
| Direct Parent | phenylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsaryl fluoridesazacyclic compoundscarbamate esterscarbonyl compoundsfluorobenzeneshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundspiperidinecarboxylic acids |
|---|
| Substituents | aryl fluoridemonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundorganohalogen compoundfluorobenzeneorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinecarboxylic acidalcoholcarbonic acid derivativeazacycleorganofluoridecarbamic acid esteraryl halideorganic oxygen compoundphenylpiperidinehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
