| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:37 UTC |
|---|
| Update Date | 2025-03-25 00:55:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02214351 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16O4 |
|---|
| Molecular Mass | 188.1049 |
|---|
| SMILES | CCOC(=O)C(C)(C)C(O)C(C)=O |
|---|
| InChI Key | AKIRNAOGICSCRB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | gamma-keto acids and derivatives |
|---|
| Direct Parent | gamma-keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyloinsalpha-hydroxy ketonesbeta hydroxy acids and derivativescarboxylic acid estersfatty acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholfatty acylaliphatic acyclic compoundcarbonyl grouphydroxy acidalpha-hydroxy ketonecarboxylic acid derivativegamma-keto acidketonefatty acid esterbeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundacyloincarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|