| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:37 UTC |
|---|
| Update Date | 2025-03-25 00:55:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02214362 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H5BrCl4O2 |
|---|
| Molecular Mass | 315.8227 |
|---|
| SMILES | CCOC(=O)C(Cl)(Br)C(Cl)(Cl)Cl |
|---|
| InChI Key | JLBGLMAHKVRYHH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | alpha-halocarboxylic acids and derivatives |
|---|
| Direct Parent | alpha-halocarboxylic acid derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl bromidesalkyl chloridescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganobromidesorganochlorides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupalkyl chlorideorganochlorideorganohalogen compoundalkyl bromidealpha-halocarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterorganobromidealkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
