| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:38 UTC |
|---|
| Update Date | 2025-03-25 00:55:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02214392 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H21NO3P+ |
|---|
| Molecular Mass | 258.1254 |
|---|
| SMILES | CCOP(C)(=O)Oc1ccc([N+](C)(C)C)cc1 |
|---|
| InChI Key | KWXBLIYFOIIGCL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxy compounds |
|---|
| Direct Parent | phenoxy compounds |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aminesaniline and substituted anilineshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganooxygen compoundsorganophosphorus compoundsorganopnictogen compoundsphosphonic acid diestersphosphonic acid estersquaternary ammonium salts |
|---|
| Substituents | aniline or substituted anilinesquaternary ammonium saltphosphonic acid diesterphosphonic acid esteraromatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationphenoxy compoundorganic saltamineorganophosphonic acid derivativeorganooxygen compound |
|---|
