| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:56 UTC |
|---|
| Update Date | 2025-03-25 00:55:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02215050 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20O6 |
|---|
| Molecular Mass | 296.126 |
|---|
| SMILES | CCC(=O)OCOC(=O)CCc1ccc(OC)c(OC)c1 |
|---|
| InChI Key | UZFXOJHGQMFYIJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | methoxybenzenes |
|---|
| Direct Parent | dimethoxybenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetalsacylalsalkyl aryl ethersanisolescarbonyl compoundsdicarboxylic acids and derivativesfatty acid estershydrocarbon derivativesorganic oxidesphenoxy compounds |
|---|
| Substituents | fatty acylphenol ethercarbonyl groupetheralkyl aryl ethercarboxylic acid derivativearomatic homomonocyclic compounddimethoxybenzeneacylalfatty acid esterorganic oxideorganic oxygen compoundacetalanisoleo-dimethoxybenzenecarboxylic acid esterdicarboxylic acid or derivativeshydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
