| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:05:57 UTC |
|---|
| Update Date | 2025-03-25 00:55:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02215074 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O4 |
|---|
| Molecular Mass | 258.0892 |
|---|
| SMILES | CCC(=O)Oc1ccc(Oc2ccc(O)cc2)cc1 |
|---|
| InChI Key | FTPOHIBYRCFQCJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidscarbonyl compoundscarboxylic acid estersdiarylethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenol estersphenol ethersphenoxy compounds |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupether1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenol esterphenolhydrocarbon derivativephenoxy compounddiphenyletherorganooxygen compound |
|---|
