| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:02 UTC |
|---|
| Update Date | 2025-03-25 00:55:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02215257 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11NO4S |
|---|
| Molecular Mass | 241.0409 |
|---|
| SMILES | CC1=Cc2cccc(OS(=O)(=O)O)c2NC1 |
|---|
| InChI Key | QMQRALDOGBOIDZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | quinolones and derivatives |
|---|
| Direct Parent | hydroquinolones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | arylsulfatesazacyclic compoundsbenzenoidshydrocarbon derivativeshydroquinolinesorganic oxidesorganooxygen compoundsorganopnictogen compoundssecondary alkylarylaminessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterorganic sulfuric acid or derivativesazacycledihydroquinolinesecondary aminesecondary aliphatic/aromatic amineorganic oxidedihydroquinoloneorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativearylsulfatebenzenoidorganic nitrogen compoundsulfuric acid esteramineorganooxygen compound |
|---|