| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:05 UTC |
|---|
| Update Date | 2025-03-25 00:55:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02215379 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H22O5 |
|---|
| Molecular Mass | 354.1467 |
|---|
| SMILES | CC1OC(CO)C(O)C(O)C1Oc1ccc2c(ccc3ccccc32)c1 |
|---|
| InChI Key | SJEHFHQZLRDJGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersdialkyl ethershydrocarbon derivativesmonosaccharidesnaphthalenesoxacyclic compoundsoxanesphenol ethersprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholphenol etherphenanthreneethermonosaccharidealkyl aryl etherdialkyl etheroxacyclesaccharidenaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundsecondary alcoholhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|
