| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 15:06:13 UTC |
|---|
| Update Date | 2025-03-25 00:56:02 UTC |
|---|
| HMDB ID | HMDB0241056 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02215706 |
|---|
| Name | 7-Hydroxydecanoylcarnitine |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H34NO5+ |
|---|
| Molecular Mass | 332.2432 |
|---|
| SMILES | CCCC(O)CCCCCC(=O)OC(CC(=O)O)C[N+](C)(C)C |
|---|
| InChI Key | CUNUJTYZIRIYAM-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acid esters |
|---|
| Direct Parent | acyl carnitines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | aminescarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativeshydroxy fatty acidsorganic cationsorganic oxidesorganic saltsorganopnictogen compoundssecondary alcoholsshort-chain hydroxy acids and derivativestetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundhydroxy fatty acidorganic cationorganic saltalcoholtetraalkylammonium saltquaternary ammonium saltacyl-carnitineorganic oxygen compoundcarboxylic acid estersecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
