| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:18 UTC |
|---|
| Update Date | 2025-03-25 00:56:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02215891 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16ClNO3 |
|---|
| Molecular Mass | 233.0819 |
|---|
| SMILES | CCC=CCCC(O)C(Cl)=NCC(=O)O |
|---|
| InChI Key | AXTCVZUKHIEMII-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidschlorohydrinshydrocarbon derivativesimidoyl chloridesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundssecondary alcohols |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidchlorohydrinorganochlorideorganohalogen compoundpropargyl-type 1,3-dipolar organic compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundalcoholhalohydrinorganic 1,3-dipolar compoundmonocarboxylic acid or derivativesorganic oxygen compoundimidoyl chlorideimidoyl halidesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|