| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-21 15:06:19 UTC |
|---|
| Update Date | 2025-03-25 00:56:04 UTC |
|---|
| HMDB ID | HMDB0010397 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02215923 |
|---|
| Name | LysoPC(20:5(5Z,8Z,11Z,14Z,17Z)/0:0) |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H49NO7P+ |
|---|
| Molecular Mass | 542.3241 |
|---|
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(O)COP(=O)(O)OCC[N+](C)(C)C |
|---|
| InChI Key | PDIGSOAOQOXRDU-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | glycerophospholipids |
|---|
| Subclass | glycerophosphocholines |
|---|
| Direct Parent | 1-acyl-sn-glycero-3-phosphocholines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | aminescarbonyl compoundscarboxylic acid estersdialkyl phosphatesfatty acid estersglycerophosphocholineshydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsphosphocholinessecondary alcoholstetraalkylammonium salts |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl group1-acyl-sn-glycero-3-phosphocholinecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganic saltalcoholtetraalkylammonium saltquaternary ammonium saltphosphocholinefatty acid esterdialkyl phosphatemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estercarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|