| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:23 UTC |
|---|
| Update Date | 2025-03-25 00:56:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02216052 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H17NO3S2 |
|---|
| Molecular Mass | 263.065 |
|---|
| SMILES | CCCCC=CC(=O)SSCC(N)C(=O)O |
|---|
| InChI Key | GVPBHRJMTNGBBI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | cysteine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic disulfidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfenyl compoundsthiocarboxylic acids and derivativesthiolactones |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupthiocarboxylic acid or derivativescarboxylic acidsulfenyl compoundorganosulfur compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganic disulfidecysteine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundthiolactoneorganooxygen compound |
|---|
