| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:23 UTC |
|---|
| Update Date | 2025-03-25 00:56:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02216078 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H18O6 |
|---|
| Molecular Mass | 234.1103 |
|---|
| SMILES | CCCCC(O)COC(CC(=O)O)C(=O)O |
|---|
| InChI Key | KUDKLAFNFGPJJA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | hydroxy fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdialkyl ethersdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidessecondary alcoholsshort-chain hydroxy acids and derivatives |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupethercarboxylic acidshort-chain hydroxy acidcarboxylic acid derivativedialkyl etherorganic oxideorganic oxygen compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativehydroxy fatty acidorganooxygen compound |
|---|
