| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:24 UTC |
|---|
| Update Date | 2025-03-25 00:56:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02216111 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H22O3 |
|---|
| Molecular Mass | 274.1569 |
|---|
| SMILES | CCCC=CC(O)CC(=O)C=Cc1ccc(OC)cc1 |
|---|
| InChI Key | WPNCUBRQPRHUFS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acryloyl compoundsalkyl aryl ethersanisolesbeta-hydroxy ketonesenonesfatty alcoholshydrocarbon derivativesmethoxybenzenesorganic oxidesphenoxy compoundssecondary alcoholsb'-hydroxy-alpha,beta-unsaturated ketones |
|---|
| Substituents | fatty acylbeta-hydroxy ketonephenol ethermonocyclic benzene moietycarbonyl groupetherb'-hydroxy-alpha,beta-unsaturated-ketonealkyl aryl etheralpha,beta-unsaturated ketoneketonecinnamic acid or derivativesorganic oxidefatty alcoholenonealcoholmethoxybenzenearomatic homomonocyclic compoundorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativebenzenoidacryloyl-groupphenoxy compoundorganooxygen compound |
|---|
