| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:29 UTC |
|---|
| Update Date | 2025-03-25 00:56:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02216307 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H28O5 |
|---|
| Molecular Mass | 384.1937 |
|---|
| SMILES | CCC(CCC(C)O)COC(=O)c1ccccc1C(=O)c1ccc(OC)cc1 |
|---|
| InChI Key | GDRWXURFVUQBNJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaryl ketonesaryl-phenylketonesbenzoic acid estersbenzoyl derivativescarboxylic acid estersdiphenylmethanesfatty alcoholshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundssecondary alcohols |
|---|
| Substituents | fatty acyldiphenylmethanephenol etheretherbenzoylbenzoate esteralkyl aryl ethercarboxylic acid derivativebenzophenoneketoneorganic oxidefatty alcoholalcoholaryl-phenylketonebenzoic acid or derivativesmethoxybenzenearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid estersecondary alcoholhydrocarbon derivativephenoxy compoundorganooxygen compoundaryl ketone |
|---|
