| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:39 UTC |
|---|
| Update Date | 2025-03-25 00:56:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02216706 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H18O2 |
|---|
| Molecular Mass | 230.1307 |
|---|
| SMILES | CCC1=C(C)C(=O)CC1Cc1cccc(O)c1 |
|---|
| InChI Key | GVKRZGRGFVKEHO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | iridoids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaromatic monoterpenoidsbenzene and substituted derivativescyclic ketoneshydrocarbon derivativesmonocyclic monoterpenoidsorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupmonocyclic monoterpenoid1-hydroxy-2-unsubstituted benzenoidcyclic ketone1-hydroxy-4-unsubstituted benzenoidketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundphenolhydrocarbon derivativebenzenoid11-noriridane monoterpenoidorganooxygen compoundaromatic monoterpenoid |
|---|
