| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:47 UTC |
|---|
| Update Date | 2025-03-25 00:56:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02216992 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H2F16O6S |
|---|
| Molecular Mass | 553.9317 |
|---|
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
|---|
| InChI Key | URDVVBQRAQKTQG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | medium-chain fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalpha-halocarboxylic acidsalpha-haloketonescarboxylic acidshalogenated fatty acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganosulfonic acidssulfonyls |
|---|
| Substituents | alpha-halocarboxylic acid or derivativesaliphatic acyclic compoundorganosulfonic acid or derivativescarbonyl groupcarboxylic acidorganosulfonic acidalpha-halocarboxylic acidorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundketoneorganic oxidealpha-haloketonealkyl halidemedium-chain fatty acidhalogenated fatty acidalkyl fluorideorganofluoridemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|