| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:48 UTC |
|---|
| Update Date | 2025-03-25 00:56:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02217029 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H15NO11S |
|---|
| Molecular Mass | 333.0366 |
|---|
| SMILES | O=C(O)C(O)NC1C(O)OC(COS(=O)(=O)O)C(O)C1O |
|---|
| InChI Key | ILJAJWFBRPOBNT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkanolaminesalkyl sulfatesalpha amino acidsalpha hydroxy acids and derivativesamino acidscarbonyl compoundscarboxylic acidsdialkylamineshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupcarboxylic acidamino acid or derivativesamino acidalpha-hydroxy acidmonosaccharidealpha-amino acid or derivativescarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxidealkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compoundalkanolamine1,2-diolalcoholsecondary aliphatic amineorganic sulfuric acid or derivativeshydroxy acidsecondary amineoxacyclemonocarboxylic acid or derivativessecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esteramine |
|---|
